C25H32N8O2 — CID 155261273
(2S)-N-[1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-2-(methylamino)propanamide (PubChem CID 155261273) has the molecular formula C25H32N8O2 and a molecular weight of 476.59 g/mol. Its IUPAC name is (2S)-N-[1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 155261273 |
| Molecular Formula | C25H32N8O2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (2S)-N-[1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-3-[4-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)NC(Cc1ccc(N=C(N)N)cc1)C(=O)N1CCCC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H32N8O2/c1-15(28-2)23(34)32-20(14-16-9-11-17(12-10-16)29-25(26)27)24(35)33-13-5-8-21(33)22-30-18-6-3-4-7-19(18)31-22/h3-4,6-7,9-12,15,20-21,28H,5,8,13-14H2,1-2H3,(H,30,31)(H,32,34)(H4,26,27,29)/t15-,20?,21?/m0/s1 |
| InChIKey | FGLYVGSXVVJJFG-VUZGARFFSA-N |
| XLogP | 1.47 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|