C16H14FN5O — CID 155262791
N-[2-fluoro-4-methyl-5-[2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]formamide (PubChem CID 155262791) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is N-[2-fluoro-4-methyl-5-[2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]formamide.
| Compound Name | N-[2-fluoro-4-methyl-5-[2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]formamide |
|---|---|
| PubChem CID | 155262791 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[2-fluoro-4-methyl-5-[2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]formamide |
| SMILES | CNc1ncc2cc(-c3cc(NC=O)c(F)cc3C)cnc2n1 |
| InChI | InChI=1S/C16H14FN5O/c1-9-3-13(17)14(21-8-23)5-12(9)10-4-11-7-20-16(18-2)22-15(11)19-6-10/h3-8H,1-2H3,(H,21,23)(H,18,19,20,22) |
| InChIKey | UXJUTEUOYZATQK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|