C20H28ClF2N5O2 — CID 155263038
4-[[4-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperazin-1-yl]methyl]-N,N-difluoropiperidine-1-carboxamide (PubChem CID 155263038) has the molecular formula C20H28ClF2N5O2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 4-[[4-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperazin-1-yl]methyl]-N,N-difluoropiperidine-1-carboxamide.
| Compound Name | 4-[[4-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperazin-1-yl]methyl]-N,N-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 155263038 |
| Molecular Formula | C20H28ClF2N5O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[[4-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperazin-1-yl]methyl]-N,N-difluoropiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCN(CC3CCN(C(=O)N(F)F)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C20H28ClF2N5O2/c1-24(2)19(29)17-4-3-16(13-18(17)21)26-11-9-25(10-12-26)14-15-5-7-27(8-6-15)20(30)28(22)23/h3-4,13,15H,5-12,14H2,1-2H3 |
| InChIKey | MRIHAVUYYHGFKU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|