C42H81NO2 — CID 155264235
3-[1-[2-decyl-11-(3-pentyloctoxy)dodec-11-enoxy]ethenyl]-1-methylpyrrolidine (PubChem CID 155264235) has the molecular formula C42H81NO2 and a molecular weight of 632.12 g/mol. Its IUPAC name is 3-[1-[2-decyl-11-(3-pentyloctoxy)dodec-11-enoxy]ethenyl]-1-methylpyrrolidine.
| Compound Name | 3-[1-[2-decyl-11-(3-pentyloctoxy)dodec-11-enoxy]ethenyl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 155264235 |
| Molecular Formula | C42H81NO2 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 631.63 |
| IUPAC Name | 3-[1-[2-decyl-11-(3-pentyloctoxy)dodec-11-enoxy]ethenyl]-1-methylpyrrolidine |
| SMILES | C=C(CCCCCCCCC(CCCCCCCCCC)COC(=C)C1CCN(C)C1)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C42H81NO2/c1-7-10-13-14-15-16-20-25-30-41(37-45-39(5)42-32-34-43(6)36-42)31-26-21-18-17-19-24-27-38(4)44-35-33-40(28-22-11-8-2)29-23-12-9-3/h40-42H,4-5,7-37H2,1-3,6H3 |
| InChIKey | UXYHLDLHXIBULM-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|