C24H22ClF2N3O4 — CID 155264852
N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxyhex-5-enyl]-6-fluoroquinoline-2-carboxamide (PubChem CID 155264852) has the molecular formula C24H22ClF2N3O4 and a molecular weight of 489.91 g/mol. Its IUPAC name is N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxyhex-5-enyl]-6-fluoroquinoline-2-carboxamide.
| Compound Name | N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxyhex-5-enyl]-6-fluoroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 155264852 |
| Molecular Formula | C24H22ClF2N3O4 |
| Molecular Weight | 489.91 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N-[(3S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxyhex-5-enyl]-6-fluoroquinoline-2-carboxamide |
| SMILES | C=CC(NC(=O)COc1ccc(Cl)c(F)c1)[C@@H](O)CCNC(=O)c1ccc2cc(F)ccc2n1 |
| InChI | InChI=1S/C24H22ClF2N3O4/c1-2-19(30-23(32)13-34-16-5-6-17(25)18(27)12-16)22(31)9-10-28-24(33)21-7-3-14-11-15(26)4-8-20(14)29-21/h2-8,11-12,19,22,31H,1,9-10,13H2,(H,28,33)(H,30,32)/t19?,22-/m0/s1 |
| InChIKey | KSJWNAWFJHFVKV-BPARTEKVSA-N |
| XLogP | 3.40 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|