C26H35F4N7O2 — CID 155269630
4-[3-[[2-[2-ethyl-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one (PubChem CID 155269630) has the molecular formula C26H35F4N7O2 and a molecular weight of 553.61 g/mol. Its IUPAC name is 4-[3-[[2-[2-ethyl-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one.
| Compound Name | 4-[3-[[2-[2-ethyl-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 155269630 |
| Molecular Formula | C26H35F4N7O2 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 4-[3-[[2-[2-ethyl-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
| SMILES | CCc1cc(N2CCN(C)CC2)c(F)cc1Nc1ncc(C(F)(F)F)c(NCCCN2CCCOCC2=O)n1 |
| InChI | InChI=1S/C26H35F4N7O2/c1-3-18-14-22(36-11-9-35(2)10-12-36)20(27)15-21(18)33-25-32-16-19(26(28,29)30)24(34-25)31-6-4-7-37-8-5-13-39-17-23(37)38/h14-16H,3-13,17H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | ZJNLOQLSMMQJCA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|