C26H34F3N7O2 — CID 155269725
4-[3-[[2-(2-cyclopropyl-4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one (PubChem CID 155269725) has the molecular formula C26H34F3N7O2 and a molecular weight of 533.60 g/mol. Its IUPAC name is 4-[3-[[2-(2-cyclopropyl-4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one.
| Compound Name | 4-[3-[[2-(2-cyclopropyl-4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 155269725 |
| Molecular Formula | C26H34F3N7O2 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 4-[3-[[2-(2-cyclopropyl-4-piperazin-1-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
| SMILES | O=C1COCCCN1CCCNc1nc(Nc2ccc(N3CCNCC3)cc2C2CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H34F3N7O2/c27-26(28,29)21-16-32-25(34-24(21)31-7-1-10-36-11-2-14-38-17-23(36)37)33-22-6-5-19(15-20(22)18-3-4-18)35-12-8-30-9-13-35/h5-6,15-16,18,30H,1-4,7-14,17H2,(H2,31,32,33,34) |
| InChIKey | SEWZZCOEMMFAIM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|