C9H20N2 — CID 155276567
1-methyl-1-[(E)-2,3,4-trimethylpent-1-enyl]hydrazine (PubChem CID 155276567) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-methyl-1-[(E)-2,3,4-trimethylpent-1-enyl]hydrazine.
| Compound Name | 1-methyl-1-[(E)-2,3,4-trimethylpent-1-enyl]hydrazine |
|---|---|
| PubChem CID | 155276567 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-methyl-1-[(E)-2,3,4-trimethylpent-1-enyl]hydrazine |
| SMILES | C/C(=C\N(C)N)C(C)C(C)C |
| InChI | InChI=1S/C9H20N2/c1-7(2)9(4)8(3)6-11(5)10/h6-7,9H,10H2,1-5H3/b8-6+ |
| InChIKey | OSEXPHJOCTWZPU-SOFGYWHQSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|