C4H12N4 — CID 155247228
(E)-2-[amino(methyl)amino]-1-N'-methylethene-1,1-diamine (PubChem CID 155247228) has the molecular formula C4H12N4 and a molecular weight of 116.17 g/mol. Its IUPAC name is (E)-2-[amino(methyl)amino]-1-N'-methylethene-1,1-diamine.
| Compound Name | (E)-2-[amino(methyl)amino]-1-N'-methylethene-1,1-diamine |
|---|---|
| PubChem CID | 155247228 |
| Molecular Formula | C4H12N4 |
| Molecular Weight | 116.17 g/mol |
| Exact Mass | 116.11 |
| IUPAC Name | (E)-2-[amino(methyl)amino]-1-N'-methylethene-1,1-diamine |
| SMILES | CN/C(N)=C/N(C)N |
| InChI | InChI=1S/C4H12N4/c1-7-4(5)3-8(2)6/h3,7H,5-6H2,1-2H3/b4-3+ |
| InChIKey | MHIBNXVTTKCUNX-ONEGZZNKSA-N |
| XLogP | -1.23 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.17 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|