C5H11BN2O2 — CID 174100005
[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid (PubChem CID 174100005) has the molecular formula C5H11BN2O2 and a molecular weight of 141.97 g/mol. Its IUPAC name is [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid.
| Compound Name | [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid |
|---|---|
| PubChem CID | 174100005 |
| Molecular Formula | C5H11BN2O2 |
| Molecular Weight | 141.97 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid |
| SMILES | C=C/C(=C\N(C)N)B(O)O |
| InChI | InChI=1S/C5H11BN2O2/c1-3-5(6(9)10)4-8(2)7/h3-4,9-10H,1,7H2,2H3/b5-4+ |
| InChIKey | GOAORCRMEAFKTL-SNAWJCMRSA-N |
| XLogP | -1.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.97 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|