[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid

C5H11BN2O2 — CID 174100005

IUPAC[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid
SMILESC=C/C(=C\N(C)N)B(O)O
InChIInChI=1S/C5H11BN2O2/c1-3-5(6(9)10)4-8(2)7/h3-4,9-10H,1,7H2,2H3/b5-4+
InChIKeyGOAORCRMEAFKTL-SNAWJCMRSA-N
MW141.97 g/mol
LogP-1.13
Rot. Bonds3

About [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid

[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid (PubChem CID 174100005) has the molecular formula C5H11BN2O2 and a molecular weight of 141.97 g/mol. Its IUPAC name is [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid.

Molecular Properties

Compound Name[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid
PubChem CID174100005
Molecular FormulaC5H11BN2O2
Molecular Weight141.97 g/mol
Exact Mass142.09
IUPAC Name[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid
SMILESC=C/C(=C\N(C)N)B(O)O
InChIInChI=1S/C5H11BN2O2/c1-3-5(6(9)10)4-8(2)7/h3-4,9-10H,1,7H2,2H3/b5-4+
InChIKeyGOAORCRMEAFKTL-SNAWJCMRSA-N
XLogP-1.13
TPSA69.72 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.97
LogP ≤ 5-1.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid?
The IUPAC name of [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid (CID 174100005) is [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid.
What is the SMILES notation for [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid?
The canonical SMILES for [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid is C=C/C(=C\N(C)N)B(O)O.
What is the InChIKey of [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid?
The InChIKey is GOAORCRMEAFKTL-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H11BN2O2/c1-3-5(6(9)10)4-8(2)7/h3-4,9-10H,1,7H2,2H3/b5-4+.
What are the key properties of [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid?
[(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid has a molecular weight of 141.97 g/mol, XLogP of -1.13, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-1-[amino(methyl)amino]buta-1,3-dien-2-yl]boronic acid is sourced from PubChem (CID 174100005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).