C12H20N2S2 — CID 155278540
3-[2-(diethylamino)ethyl-methylamino]-4-methylcyclobut-3-ene-1,2-dithione (PubChem CID 155278540) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl-methylamino]-4-methylcyclobut-3-ene-1,2-dithione.
| Compound Name | 3-[2-(diethylamino)ethyl-methylamino]-4-methylcyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 155278540 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[2-(diethylamino)ethyl-methylamino]-4-methylcyclobut-3-ene-1,2-dithione |
| SMILES | CCN(CC)CCN(C)c1c(C)c(=S)c1=S |
| InChI | InChI=1S/C12H20N2S2/c1-5-14(6-2)8-7-13(4)10-9(3)11(15)12(10)16/h5-8H2,1-4H3 |
| InChIKey | DHJDFCNFZJHPRB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|