C13H22N2S2 — CID 155278397
3-[butyl(methyl)amino]-4-(diethylamino)cyclobut-3-ene-1,2-dithione (PubChem CID 155278397) has the molecular formula C13H22N2S2 and a molecular weight of 270.47 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-4-(diethylamino)cyclobut-3-ene-1,2-dithione.
| Compound Name | 3-[butyl(methyl)amino]-4-(diethylamino)cyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 155278397 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[butyl(methyl)amino]-4-(diethylamino)cyclobut-3-ene-1,2-dithione |
| SMILES | CCCCN(C)c1c(N(CC)CC)c(=S)c1=S |
| InChI | InChI=1S/C13H22N2S2/c1-5-8-9-14(4)10-11(13(17)12(10)16)15(6-2)7-3/h5-9H2,1-4H3 |
| InChIKey | GBXOBOFYPSRGSQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|