C14H26N2S2 — CID 156727832
3-(butylamino)-4-(diethylamino)cyclobut-3-ene-1,2-dithione;ethane (PubChem CID 156727832) has the molecular formula C14H26N2S2 and a molecular weight of 286.51 g/mol. Its IUPAC name is 3-(butylamino)-4-(diethylamino)cyclobut-3-ene-1,2-dithione;ethane.
| Compound Name | 3-(butylamino)-4-(diethylamino)cyclobut-3-ene-1,2-dithione;ethane |
|---|---|
| PubChem CID | 156727832 |
| Molecular Formula | C14H26N2S2 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-(butylamino)-4-(diethylamino)cyclobut-3-ene-1,2-dithione;ethane |
| SMILES | CC.CCCCNc1c(N(CC)CC)c(=S)c1=S |
| InChI | InChI=1S/C12H20N2S2.C2H6/c1-4-7-8-13-9-10(12(16)11(9)15)14(5-2)6-3;1-2/h13H,4-8H2,1-3H3;1-2H3 |
| InChIKey | NJNHWRVPCRWKKZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|