C19H19N8O4P — CID 155282703
benzotriazol-1-yl N-[3-[[amino-(phosphanylamino)methylidene]amino]propyl]-N-(1,3-dioxoisoindol-2-yl)carbamate (PubChem CID 155282703) has the molecular formula C19H19N8O4P and a molecular weight of 454.39 g/mol. Its IUPAC name is benzotriazol-1-yl N-[3-[[amino-(phosphanylamino)methylidene]amino]propyl]-N-(1,3-dioxoisoindol-2-yl)carbamate.
| Compound Name | benzotriazol-1-yl N-[3-[[amino-(phosphanylamino)methylidene]amino]propyl]-N-(1,3-dioxoisoindol-2-yl)carbamate |
|---|---|
| PubChem CID | 155282703 |
| Molecular Formula | C19H19N8O4P |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | benzotriazol-1-yl N-[3-[[amino-(phosphanylamino)methylidene]amino]propyl]-N-(1,3-dioxoisoindol-2-yl)carbamate |
| SMILES | N/C(=N\CCCN(C(=O)On1nnc2ccccc21)N1C(=O)c2ccccc2C1=O)NP |
| InChI | InChI=1S/C19H19N8O4P/c20-18(23-32)21-10-5-11-25(26-16(28)12-6-1-2-7-13(12)17(26)29)19(30)31-27-15-9-4-3-8-14(15)22-24-27/h1-4,6-9H,5,10-11,32H2,(H3,20,21,23) |
| InChIKey | FSXBYWUYMVCJPP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 148.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|