C10H11F2NO — CID 155287046
6-(1,1-difluoroethyl)-1,3-dihydro-2-benzofuran-4-amine (PubChem CID 155287046) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-1,3-dihydro-2-benzofuran-4-amine.
| Compound Name | 6-(1,1-difluoroethyl)-1,3-dihydro-2-benzofuran-4-amine |
|---|---|
| PubChem CID | 155287046 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-(1,1-difluoroethyl)-1,3-dihydro-2-benzofuran-4-amine |
| SMILES | CC(F)(F)c1cc(N)c2c(c1)COC2 |
| InChI | InChI=1S/C10H11F2NO/c1-10(11,12)7-2-6-4-14-5-8(6)9(13)3-7/h2-3H,4-5,13H2,1H3 |
| InChIKey | BZWCWPYJYBQWSF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|