C8H7BrClNO — CID 164912930
4-bromo-6-chloro-1,3-dihydro-2-benzofuran-5-amine (PubChem CID 164912930) has the molecular formula C8H7BrClNO and a molecular weight of 248.51 g/mol. Its IUPAC name is 4-bromo-6-chloro-1,3-dihydro-2-benzofuran-5-amine.
| Compound Name | 4-bromo-6-chloro-1,3-dihydro-2-benzofuran-5-amine |
|---|---|
| PubChem CID | 164912930 |
| Molecular Formula | C8H7BrClNO |
| Molecular Weight | 248.51 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 4-bromo-6-chloro-1,3-dihydro-2-benzofuran-5-amine |
| SMILES | Nc1c(Cl)cc2c(c1Br)COC2 |
| InChI | InChI=1S/C8H7BrClNO/c9-7-5-3-12-2-4(5)1-6(10)8(7)11/h1H,2-3,11H2 |
| InChIKey | HAKDVISGLKEWPZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|