C8H7I2NO — CID 164908392
5,7-diiodo-1,3-dihydro-2-benzofuran-4-amine (PubChem CID 164908392) has the molecular formula C8H7I2NO and a molecular weight of 386.96 g/mol. Its IUPAC name is 5,7-diiodo-1,3-dihydro-2-benzofuran-4-amine.
| Compound Name | 5,7-diiodo-1,3-dihydro-2-benzofuran-4-amine |
|---|---|
| PubChem CID | 164908392 |
| Molecular Formula | C8H7I2NO |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.86 |
| IUPAC Name | 5,7-diiodo-1,3-dihydro-2-benzofuran-4-amine |
| SMILES | Nc1c(I)cc(I)c2c1COC2 |
| InChI | InChI=1S/C8H7I2NO/c9-6-1-7(10)8(11)5-3-12-2-4(5)6/h1H,2-3,11H2 |
| InChIKey | XUAHEVNZMACFLT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|