About 3,4-diamino-5-iodophenol
3,4-diamino-5-iodophenol (PubChem CID 163601326) has the molecular formula C6H7IN2O
and a molecular weight of 250.04 g/mol. Its IUPAC name is 3,4-diamino-5-iodophenol.
Molecular Properties
| Compound Name | 3,4-diamino-5-iodophenol |
| PubChem CID | 163601326 |
| Molecular Formula | C6H7IN2O |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | 3,4-diamino-5-iodophenol |
| SMILES | Nc1cc(O)cc(I)c1N |
| InChI | InChI=1S/C6H7IN2O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H,8-9H2 |
| InChIKey | GXXCVOZSQBZCCF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-5-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-5-iodophenol?
The IUPAC name of 3,4-diamino-5-iodophenol (CID 163601326) is 3,4-diamino-5-iodophenol.
What is the SMILES notation for 3,4-diamino-5-iodophenol?
The canonical SMILES for 3,4-diamino-5-iodophenol is Nc1cc(O)cc(I)c1N.
What is the InChIKey of 3,4-diamino-5-iodophenol?
The InChIKey is GXXCVOZSQBZCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H,8-9H2.
What are the key properties of 3,4-diamino-5-iodophenol?
3,4-diamino-5-iodophenol has a molecular weight of 250.04 g/mol, XLogP of 1.16, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-5-iodophenol is sourced from PubChem (CID 163601326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).