C9H10INO — CID 53420061
7-iodo-3,4-dihydro-1H-isochromen-6-amine (PubChem CID 53420061) has the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. Its IUPAC name is 7-iodo-3,4-dihydro-1H-isochromen-6-amine.
| Compound Name | 7-iodo-3,4-dihydro-1H-isochromen-6-amine |
|---|---|
| PubChem CID | 53420061 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 7-iodo-3,4-dihydro-1H-isochromen-6-amine |
| SMILES | Nc1cc2c(cc1I)COCC2 |
| InChI | InChI=1S/C9H10INO/c10-8-3-7-5-12-2-1-6(7)4-9(8)11/h3-4H,1-2,5,11H2 |
| InChIKey | FVKCTVQLPZRGIJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|