C9H12N2O2 — CID 105438665
2-methoxy-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-amine (PubChem CID 105438665) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-methoxy-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-amine.
| Compound Name | 2-methoxy-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 105438665 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-methoxy-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-amine |
| SMILES | COc1nc2c(cc1N)CCOC2 |
| InChI | InChI=1S/C9H12N2O2/c1-12-9-7(10)4-6-2-3-13-5-8(6)11-9/h4H,2-3,5,10H2,1H3 |
| InChIKey | USWZQIMNEJRARL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |