C8H8ClN3 — CID 155294268
3-chloro-7-methylimidazo[1,2-a]pyridin-6-amine (PubChem CID 155294268) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 3-chloro-7-methylimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 3-chloro-7-methylimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 155294268 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 3-chloro-7-methylimidazo[1,2-a]pyridin-6-amine |
| SMILES | Cc1cc2ncc(Cl)n2cc1N |
| InChI | InChI=1S/C8H8ClN3/c1-5-2-8-11-3-7(9)12(8)4-6(5)10/h2-4H,10H2,1H3 |
| InChIKey | PAYPDLYEMRDPAI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |