C20H23F3N2O3 — CID 155294857
[7-[[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-3-bicyclo[3.3.1]nonanyl] acetate (PubChem CID 155294857) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is [7-[[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-3-bicyclo[3.3.1]nonanyl] acetate.
| Compound Name | [7-[[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-3-bicyclo[3.3.1]nonanyl] acetate |
|---|---|
| PubChem CID | 155294857 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [7-[[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]carbamoyl]-3-bicyclo[3.3.1]nonanyl] acetate |
| SMILES | CC(=O)OC1CC2CC(C1)CC(C(=O)N/N=C/c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C20H23F3N2O3/c1-12(26)28-18-9-14-6-15(10-18)8-16(7-14)19(27)25-24-11-13-2-4-17(5-3-13)20(21,22)23/h2-5,11,14-16,18H,6-10H2,1H3,(H,25,27)/b24-11+ |
| InChIKey | VKBQFNWELSDBLJ-BHGWPJFGSA-N |
| XLogP | 3.91 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|