C28H38N2O5S — CID 155294994
ethyl-di(propan-2-yl)azanium;3-[2-(6-methoxynaphthalen-2-yl)propanoylamino]benzenesulfonate (PubChem CID 155294994) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is ethyl-di(propan-2-yl)azanium;3-[2-(6-methoxynaphthalen-2-yl)propanoylamino]benzenesulfonate.
| Compound Name | ethyl-di(propan-2-yl)azanium;3-[2-(6-methoxynaphthalen-2-yl)propanoylamino]benzenesulfonate |
|---|---|
| PubChem CID | 155294994 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | ethyl-di(propan-2-yl)azanium;3-[2-(6-methoxynaphthalen-2-yl)propanoylamino]benzenesulfonate |
| SMILES | CC[NH+](C(C)C)C(C)C.COc1ccc2cc(C(C)C(=O)Nc3cccc(S(=O)(=O)[O-])c3)ccc2c1 |
| InChI | InChI=1S/C20H19NO5S.C8H19N/c1-13(14-6-7-16-11-18(26-2)9-8-15(16)10-14)20(22)21-17-4-3-5-19(12-17)27(23,24)25;1-6-9(7(2)3)8(4)5/h3-13H,1-2H3,(H,21,22)(H,23,24,25);7-8H,6H2,1-5H3 |
| InChIKey | DXQJJBIBMVMCTI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|