C19H21FN2O2S — CID 155298425
N-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-methyl-2-pyridinyl)sulfanyl]-4-oxopentanamide (PubChem CID 155298425) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-methyl-2-pyridinyl)sulfanyl]-4-oxopentanamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-methyl-2-pyridinyl)sulfanyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 155298425 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-methyl-2-pyridinyl)sulfanyl]-4-oxopentanamide |
| SMILES | CC(=O)C(CC(=O)NCc1ccc(C)c(F)c1)Sc1ncccc1C |
| InChI | InChI=1S/C19H21FN2O2S/c1-12-6-7-15(9-16(12)20)11-22-18(24)10-17(14(3)23)25-19-13(2)5-4-8-21-19/h4-9,17H,10-11H2,1-3H3,(H,22,24) |
| InChIKey | NYVUVYZOCWKIRI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |