About (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol
(4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol (PubChem CID 155300456) has the molecular formula C9H13BrO2
and a molecular weight of 233.10 g/mol. Its IUPAC name is (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol.
Molecular Properties
| Compound Name | (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol |
| PubChem CID | 155300456 |
| Molecular Formula | C9H13BrO2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol |
| SMILES | C=C(Br)/C=C(/CCCO)C(=C)O |
| InChI | InChI=1S/C9H13BrO2/c1-7(10)6-9(8(2)12)4-3-5-11/h6,11-12H,1-5H2/b9-6- |
| InChIKey | WDIRWOICEOSAFT-TWGQIWQCSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol?
The IUPAC name of (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol (CID 155300456) is (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol.
What is the SMILES notation for (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol?
The canonical SMILES for (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol is C=C(Br)/C=C(/CCCO)C(=C)O.
What is the InChIKey of (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol?
The InChIKey is WDIRWOICEOSAFT-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H13BrO2/c1-7(10)6-9(8(2)12)4-3-5-11/h6,11-12H,1-5H2/b9-6-.
What are the key properties of (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol?
(4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol has a molecular weight of 233.10 g/mol, XLogP of 2.67, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(2-bromoprop-2-enylidene)hex-5-ene-1,5-diol is sourced from PubChem (CID 155300456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).