C14H11Cl2N3O2S — CID 155301324
3-[(6-chloro-3-pyridinyl)methyl-[(2-chloro-1,3-thiazol-5-yl)methyl]amino]-2H-furan-5-one (PubChem CID 155301324) has the molecular formula C14H11Cl2N3O2S and a molecular weight of 356.23 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl-[(2-chloro-1,3-thiazol-5-yl)methyl]amino]-2H-furan-5-one.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl-[(2-chloro-1,3-thiazol-5-yl)methyl]amino]-2H-furan-5-one |
|---|---|
| PubChem CID | 155301324 |
| Molecular Formula | C14H11Cl2N3O2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl-[(2-chloro-1,3-thiazol-5-yl)methyl]amino]-2H-furan-5-one |
| SMILES | O=C1C=C(N(Cc2ccc(Cl)nc2)Cc2cnc(Cl)s2)CO1 |
| InChI | InChI=1S/C14H11Cl2N3O2S/c15-12-2-1-9(4-17-12)6-19(10-3-13(20)21-8-10)7-11-5-18-14(16)22-11/h1-5H,6-8H2 |
| InChIKey | OMSHAGWPAATPNY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|