C16H15ClF2N2O4 — CID 89124301
3-[(6-chloro-3-pyridinyl)methyl-(2,2-difluoroethyl)amino]-2H-furan-5-one;2H-furan-5-one (PubChem CID 89124301) has the molecular formula C16H15ClF2N2O4 and a molecular weight of 372.76 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl-(2,2-difluoroethyl)amino]-2H-furan-5-one;2H-furan-5-one.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl-(2,2-difluoroethyl)amino]-2H-furan-5-one;2H-furan-5-one |
|---|---|
| PubChem CID | 89124301 |
| Molecular Formula | C16H15ClF2N2O4 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl-(2,2-difluoroethyl)amino]-2H-furan-5-one;2H-furan-5-one |
| SMILES | O=C1C=C(N(Cc2ccc(Cl)nc2)CC(F)F)CO1.O=C1C=CCO1 |
| InChI | InChI=1S/C12H11ClF2N2O2.C4H4O2/c13-10-2-1-8(4-16-10)5-17(6-11(14)15)9-3-12(18)19-7-9;5-4-2-1-3-6-4/h1-4,11H,5-7H2;1-2H,3H2 |
| InChIKey | CGRWRZWBADTRTB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|