C13H13ClF2N2O — CID 141191912
N-[(6-chloro-3-pyridinyl)methyl]-N-(2,2-difluoroethyl)-2-methylfuran-3-amine (PubChem CID 141191912) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-(2,2-difluoroethyl)-2-methylfuran-3-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-(2,2-difluoroethyl)-2-methylfuran-3-amine |
|---|---|
| PubChem CID | 141191912 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-(2,2-difluoroethyl)-2-methylfuran-3-amine |
| SMILES | Cc1occc1N(Cc1ccc(Cl)nc1)CC(F)F |
| InChI | InChI=1S/C13H13ClF2N2O/c1-9-11(4-5-19-9)18(8-13(15)16)7-10-2-3-12(14)17-6-10/h2-6,13H,7-8H2,1H3 |
| InChIKey | UGLIHDQFNGLSBM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|