C17H13Cl3N2O — CID 175725481
N-[(6-chloro-3-pyridinyl)methyl]-N-[(3,4-dichlorophenyl)methyl]furan-3-amine (PubChem CID 175725481) has the molecular formula C17H13Cl3N2O and a molecular weight of 367.66 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-[(3,4-dichlorophenyl)methyl]furan-3-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-[(3,4-dichlorophenyl)methyl]furan-3-amine |
|---|---|
| PubChem CID | 175725481 |
| Molecular Formula | C17H13Cl3N2O |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-[(3,4-dichlorophenyl)methyl]furan-3-amine |
| SMILES | Clc1ccc(CN(Cc2ccc(Cl)c(Cl)c2)c2ccoc2)cn1 |
| InChI | InChI=1S/C17H13Cl3N2O/c18-15-3-1-12(7-16(15)19)9-22(14-5-6-23-11-14)10-13-2-4-17(20)21-8-13/h1-8,11H,9-10H2 |
| InChIKey | DYOCTQGJUCIVNQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|