C17H12ClF3N2O — CID 175725650
N-[(6-chloro-3-pyridinyl)methyl]-N-[(2,4,6-trifluorophenyl)methyl]furan-3-amine (PubChem CID 175725650) has the molecular formula C17H12ClF3N2O and a molecular weight of 352.74 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-[(2,4,6-trifluorophenyl)methyl]furan-3-amine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-[(2,4,6-trifluorophenyl)methyl]furan-3-amine |
|---|---|
| PubChem CID | 175725650 |
| Molecular Formula | C17H12ClF3N2O |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-[(2,4,6-trifluorophenyl)methyl]furan-3-amine |
| SMILES | Fc1cc(F)c(CN(Cc2ccc(Cl)nc2)c2ccoc2)c(F)c1 |
| InChI | InChI=1S/C17H12ClF3N2O/c18-17-2-1-11(7-22-17)8-23(13-3-4-24-10-13)9-14-15(20)5-12(19)6-16(14)21/h1-7,10H,8-9H2 |
| InChIKey | WXWGYHGUAXKMKM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|