C38H33NO2 — CID 155306291
9,23-dibutyl-4-(3,4-dimethylphenyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(21),2(6),7(20),8,10(19),11,13(18),14,16,22-decaene-3,5-dione (PubChem CID 155306291) has the molecular formula C38H33NO2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 9,23-dibutyl-4-(3,4-dimethylphenyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(21),2(6),7(20),8,10(19),11,13(18),14,16,22-decaene-3,5-dione.
| Compound Name | 9,23-dibutyl-4-(3,4-dimethylphenyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(21),2(6),7(20),8,10(19),11,13(18),14,16,22-decaene-3,5-dione |
|---|---|
| PubChem CID | 155306291 |
| Molecular Formula | C38H33NO2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 9,23-dibutyl-4-(3,4-dimethylphenyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(21),2(6),7(20),8,10(19),11,13(18),14,16,22-decaene-3,5-dione |
| SMILES | CCCCc1cc2c3c(=O)n(-c4ccc(C)c(C)c4)c(=O)c3c3cc(CCCC)c4ccc5ccc1c1c5c4c3c21 |
| InChI | InChI=1S/C38H33NO2/c1-5-7-9-23-18-28-33-31-26(23)15-12-22-13-16-27-24(10-8-6-2)19-29(34(33)32(27)30(22)31)36-35(28)37(40)39(38(36)41)25-14-11-20(3)21(4)17-25/h11-19H,5-10H2,1-4H3 |
| InChIKey | MSTUGVBYRVBVQN-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|