C21H20N2OS2 — CID 155306382
2-amino-3-phenyl-3,3-bis(phenylsulfanyl)propanamide (PubChem CID 155306382) has the molecular formula C21H20N2OS2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-amino-3-phenyl-3,3-bis(phenylsulfanyl)propanamide.
| Compound Name | 2-amino-3-phenyl-3,3-bis(phenylsulfanyl)propanamide |
|---|---|
| PubChem CID | 155306382 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-amino-3-phenyl-3,3-bis(phenylsulfanyl)propanamide |
| SMILES | NC(=O)C(N)C(Sc1ccccc1)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2OS2/c22-19(20(23)24)21(16-10-4-1-5-11-16,25-17-12-6-2-7-13-17)26-18-14-8-3-9-15-18/h1-15,19H,22H2,(H2,23,24) |
| InChIKey | JHMSQSQIPIODSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|