C22H27N7O2 — CID 155307412
3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-pyrrolidin-2-yl]-2H-imidazole-4-carboxamide (PubChem CID 155307412) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-pyrrolidin-2-yl]-2H-imidazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-pyrrolidin-2-yl]-2H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 155307412 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-pyrrolidin-2-yl]-2H-imidazole-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2ccc(C3=C(C(N)=O)N(N)C([C@@H]4CCCN4)N3C)cc2)c1 |
| InChI | InChI=1S/C22H27N7O2/c1-13-9-11-26-17(12-13)27-21(31)15-7-5-14(6-8-15)18-19(20(23)30)29(24)22(28(18)2)16-4-3-10-25-16/h5-9,11-12,16,22,25H,3-4,10,24H2,1-2H3,(H2,23,30)(H,26,27,31)/t16-,22?/m0/s1 |
| InChIKey | KIIDOZVQNONBOI-CISYCMJJSA-N |
| XLogP | 1.00 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|