C27H33N7O3 — CID 155307472
3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-1-[(E)-pent-2-enoyl]pyrrolidin-2-yl]-2H-imidazole-4-carboxamide (PubChem CID 155307472) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-1-[(E)-pent-2-enoyl]pyrrolidin-2-yl]-2H-imidazole-4-carboxamide.
| Compound Name | 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-1-[(E)-pent-2-enoyl]pyrrolidin-2-yl]-2H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 155307472 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 3-amino-1-methyl-5-[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]-2-[(2S)-1-[(E)-pent-2-enoyl]pyrrolidin-2-yl]-2H-imidazole-4-carboxamide |
| SMILES | CC/C=C/C(=O)N1CCC[C@H]1C1N(C)C(c2ccc(C(=O)Nc3cc(C)ccn3)cc2)=C(C(N)=O)N1N |
| InChI | InChI=1S/C27H33N7O3/c1-4-5-8-22(35)33-15-6-7-20(33)27-32(3)23(24(25(28)36)34(27)29)18-9-11-19(12-10-18)26(37)31-21-16-17(2)13-14-30-21/h5,8-14,16,20,27H,4,6-7,15,29H2,1-3H3,(H2,28,36)(H,30,31,37)/b8-5+/t20-,27?/m0/s1 |
| InChIKey | DNGJFGIJHINZAO-MIGASDBESA-N |
| XLogP | 2.20 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|