C24H30F2N2 — CID 155308096
N-[(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl]-1-(1,8,8-trimethyl-2,9-dimethylidene-6,7-dihydroquinolizin-3-yl)ethenamine (PubChem CID 155308096) has the molecular formula C24H30F2N2 and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl]-1-(1,8,8-trimethyl-2,9-dimethylidene-6,7-dihydroquinolizin-3-yl)ethenamine.
| Compound Name | N-[(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl]-1-(1,8,8-trimethyl-2,9-dimethylidene-6,7-dihydroquinolizin-3-yl)ethenamine |
|---|---|
| PubChem CID | 155308096 |
| Molecular Formula | C24H30F2N2 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)methyl]-1-(1,8,8-trimethyl-2,9-dimethylidene-6,7-dihydroquinolizin-3-yl)ethenamine |
| SMILES | C=C(NCC1=CCC(C)(F)C=C1F)C1=CN2CCC(C)(C)C(=C)C2=C(C)C1=C |
| InChI | InChI=1S/C24H30F2N2/c1-15-16(2)22-17(3)23(5,6)10-11-28(22)14-20(15)18(4)27-13-19-8-9-24(7,26)12-21(19)25/h8,12,14,27H,1,3-4,9-11,13H2,2,5-7H3 |
| InChIKey | LJWZCMSPQJWPAB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |