C28H23N5O2S — CID 155308795
N-[4-[4-amino-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide (PubChem CID 155308795) has the molecular formula C28H23N5O2S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[4-[4-amino-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-amino-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 155308795 |
| Molecular Formula | C28H23N5O2S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[4-[4-amino-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2sc3ncnc(N)c3c2-c2ccc(Oc3cccc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C28H23N5O2S/c1-16(2)27(34)33-20-11-7-19(8-12-20)25-23(24-26(29)30-15-31-28(24)36-25)18-9-13-21(14-10-18)35-22-6-4-5-17(3)32-22/h4-15H,1H2,2-3H3,(H,33,34)(H2,29,30,31) |
| InChIKey | YWKFUCYRAHBPLW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|