C24H22N4OS — CID 69058758
N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)prop-2-enamide (PubChem CID 69058758) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69058758 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)prop-2-enamide |
| SMILES | CCc1sc2ncnc(N)c2c1-c1ccc(NC(=O)C=Cc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C24H22N4OS/c1-3-19-21(22-23(25)26-14-27-24(22)30-19)17-8-10-18(11-9-17)28-20(29)12-7-16-6-4-5-15(2)13-16/h4-14H,3H2,1-2H3,(H,28,29)(H2,25,26,27) |
| InChIKey | SUZJFEHKSBGINU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|