C24H19F3N4OS — CID 69058611
(E)-N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 69058611) has the molecular formula C24H19F3N4OS and a molecular weight of 468.50 g/mol. Its IUPAC name is (E)-N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69058611 |
| Molecular Formula | C24H19F3N4OS |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (E)-N-[4-(4-amino-6-ethylthieno[2,3-d]pyrimidin-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCc1sc2ncnc(N)c2c1-c1ccc(NC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H19F3N4OS/c1-2-18-20(21-22(28)29-13-30-23(21)33-18)15-7-9-17(10-8-15)31-19(32)11-6-14-4-3-5-16(12-14)24(25,26)27/h3-13H,2H2,1H3,(H,31,32)(H2,28,29,30)/b11-6+ |
| InChIKey | APRPRCZZFQJMRI-IZZDOVSWSA-N |
| XLogP | 6.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|