C30H30N6OS — CID 69062002
1-[4-[4-amino-6-[[4-(dimethylamino)phenyl]methyl]thieno[2,3-d]pyrimidin-5-yl]phenyl]-3-(3-ethylphenyl)urea (PubChem CID 69062002) has the molecular formula C30H30N6OS and a molecular weight of 522.68 g/mol. Its IUPAC name is 1-[4-[4-amino-6-[[4-(dimethylamino)phenyl]methyl]thieno[2,3-d]pyrimidin-5-yl]phenyl]-3-(3-ethylphenyl)urea.
| Compound Name | 1-[4-[4-amino-6-[[4-(dimethylamino)phenyl]methyl]thieno[2,3-d]pyrimidin-5-yl]phenyl]-3-(3-ethylphenyl)urea |
|---|---|
| PubChem CID | 69062002 |
| Molecular Formula | C30H30N6OS |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1-[4-[4-amino-6-[[4-(dimethylamino)phenyl]methyl]thieno[2,3-d]pyrimidin-5-yl]phenyl]-3-(3-ethylphenyl)urea |
| SMILES | CCc1cccc(NC(=O)Nc2ccc(-c3c(Cc4ccc(N(C)C)cc4)sc4ncnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C30H30N6OS/c1-4-19-6-5-7-23(16-19)35-30(37)34-22-12-10-21(11-13-22)26-25(38-29-27(26)28(31)32-18-33-29)17-20-8-14-24(15-9-20)36(2)3/h5-16,18H,4,17H2,1-3H3,(H2,31,32,33)(H2,34,35,37) |
| InChIKey | QKOKRTWMLLLNIY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|