C22H23N5S — CID 69057953
5-(4-aminophenyl)-6-[2-[4-(dimethylamino)phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 69057953) has the molecular formula C22H23N5S and a molecular weight of 389.53 g/mol. Its IUPAC name is 5-(4-aminophenyl)-6-[2-[4-(dimethylamino)phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-aminophenyl)-6-[2-[4-(dimethylamino)phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69057953 |
| Molecular Formula | C22H23N5S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-(4-aminophenyl)-6-[2-[4-(dimethylamino)phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)c1ccc(CCc2sc3ncnc(N)c3c2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C22H23N5S/c1-27(2)17-10-3-14(4-11-17)5-12-18-19(15-6-8-16(23)9-7-15)20-21(24)25-13-26-22(20)28-18/h3-4,6-11,13H,5,12,23H2,1-2H3,(H2,24,25,26) |
| InChIKey | OTVAVOZUINMVOV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|