C24H21N5O3 — CID 155310863
methyl 4-[4-amino-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]benzoate (PubChem CID 155310863) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is methyl 4-[4-amino-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]benzoate.
| Compound Name | methyl 4-[4-amino-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]benzoate |
|---|---|
| PubChem CID | 155310863 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 4-[4-amino-6-[4-(2-methylprop-2-enoylamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]benzoate |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2cn3ncnc(N)c3c2-c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C24H21N5O3/c1-14(2)23(30)28-18-10-8-15(9-11-18)19-12-29-21(22(25)26-13-27-29)20(19)16-4-6-17(7-5-16)24(31)32-3/h4-13H,1H2,2-3H3,(H,28,30)(H2,25,26,27) |
| InChIKey | PTZXBYMINPQNFW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|