C24H19F3N8O3 — CID 58118791
methyl 2-[4-[4-amino-6-(2,2,2-trifluoroethylcarbamoyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]anilino]-1H-benzimidazole-4-carboxylate (PubChem CID 58118791) has the molecular formula C24H19F3N8O3 and a molecular weight of 524.46 g/mol. Its IUPAC name is methyl 2-[4-[4-amino-6-(2,2,2-trifluoroethylcarbamoyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]anilino]-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-[4-[4-amino-6-(2,2,2-trifluoroethylcarbamoyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]anilino]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 58118791 |
| Molecular Formula | C24H19F3N8O3 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | methyl 2-[4-[4-amino-6-(2,2,2-trifluoroethylcarbamoyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]anilino]-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2[nH]c(Nc3ccc(-c4c(C(=O)NCC(F)(F)F)cn5ncnc(N)c45)cc3)nc12 |
| InChI | InChI=1S/C24H19F3N8O3/c1-38-22(37)14-3-2-4-16-18(14)34-23(33-16)32-13-7-5-12(6-8-13)17-15(21(36)29-10-24(25,26)27)9-35-19(17)20(28)30-11-31-35/h2-9,11H,10H2,1H3,(H,29,36)(H2,28,30,31)(H2,32,33,34) |
| InChIKey | BKQCBWLJTIWPFL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |