C20H16F3N5O — CID 155312490
N-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-methylcarbonimidoyl]-3-pyridin-2-ylquinoline-7-carboxamide (PubChem CID 155312490) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is N-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-methylcarbonimidoyl]-3-pyridin-2-ylquinoline-7-carboxamide.
| Compound Name | N-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-methylcarbonimidoyl]-3-pyridin-2-ylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 155312490 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-methylcarbonimidoyl]-3-pyridin-2-ylquinoline-7-carboxamide |
| SMILES | C/N=C(/C=C(\N)C(F)(F)F)NC(=O)c1ccc2cc(-c3ccccn3)cnc2c1 |
| InChI | InChI=1S/C20H16F3N5O/c1-25-18(10-17(24)20(21,22)23)28-19(29)13-6-5-12-8-14(11-27-16(12)9-13)15-4-2-3-7-26-15/h2-11H,24H2,1H3,(H,25,28,29)/b17-10- |
| InChIKey | OKGPWCYVOJROAR-YVLHZVERSA-N |
| XLogP | 3.46 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|