C35H41N7O5S — CID 155314985
1-[3-tert-butyl-5-(methanesulfonamido)phenyl]-3-[(1S,4R)-1-formyl-4-[[3-[(2S)-1-methylpiperidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-4H-naphthalen-1-yl]urea (PubChem CID 155314985) has the molecular formula C35H41N7O5S and a molecular weight of 671.82 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-(methanesulfonamido)phenyl]-3-[(1S,4R)-1-formyl-4-[[3-[(2S)-1-methylpiperidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-4H-naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-5-(methanesulfonamido)phenyl]-3-[(1S,4R)-1-formyl-4-[[3-[(2S)-1-methylpiperidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-4H-naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 155314985 |
| Molecular Formula | C35H41N7O5S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | 1-[3-tert-butyl-5-(methanesulfonamido)phenyl]-3-[(1S,4R)-1-formyl-4-[[3-[(2S)-1-methylpiperidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]oxy]-4H-naphthalen-1-yl]urea |
| SMILES | CN1CCCC[C@H]1c1nnc2ccc(O[C@@H]3C=C[C@](C=O)(NC(=O)Nc4cc(NS(C)(=O)=O)cc(C(C)(C)C)c4)c4ccccc43)cn12 |
| InChI | InChI=1S/C35H41N7O5S/c1-34(2,3)23-18-24(20-25(19-23)40-48(5,45)46)36-33(44)37-35(22-43)16-15-30(27-10-6-7-11-28(27)35)47-26-13-14-31-38-39-32(42(31)21-26)29-12-8-9-17-41(29)4/h6-7,10-11,13-16,18-22,29-30,40H,8-9,12,17H2,1-5H3,(H2,36,37,44)/t29-,30+,35+/m0/s1 |
| InChIKey | RTFICOBURONZIR-CMKKOEAFSA-N |
| XLogP | 5.46 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|