About sodium;decanoyl sulfate;ethoxyethane
sodium;decanoyl sulfate;ethoxyethane (PubChem CID 155316659) has the molecular formula C14H29NaO6S
and a molecular weight of 348.44 g/mol. Its IUPAC name is sodium;decanoyl sulfate;ethoxyethane.
Molecular Properties
| Compound Name | sodium;decanoyl sulfate;ethoxyethane |
| PubChem CID | 155316659 |
| Molecular Formula | C14H29NaO6S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | sodium;decanoyl sulfate;ethoxyethane |
| SMILES | CCCCCCCCCC(=O)OS(=O)(=O)[O-].CCOCC.[Na+] |
| InChI | InChI=1S/C10H20O5S.C4H10O.Na/c1-2-3-4-5-6-7-8-9-10(11)15-16(12,13)14;1-3-5-4-2;/h2-9H2,1H3,(H,12,13,14);3-4H2,1-2H3;/q;;+1/p-1 |
| InChIKey | FLHFXZPDZVUGND-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;decanoyl sulfate;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;decanoyl sulfate;ethoxyethane?
The IUPAC name of sodium;decanoyl sulfate;ethoxyethane (CID 155316659) is sodium;decanoyl sulfate;ethoxyethane.
What is the SMILES notation for sodium;decanoyl sulfate;ethoxyethane?
The canonical SMILES for sodium;decanoyl sulfate;ethoxyethane is CCCCCCCCCC(=O)OS(=O)(=O)[O-].CCOCC.[Na+].
What is the InChIKey of sodium;decanoyl sulfate;ethoxyethane?
The InChIKey is FLHFXZPDZVUGND-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O5S.C4H10O.Na/c1-2-3-4-5-6-7-8-9-10(11)15-16(12,13)14;1-3-5-4-2;/h2-9H2,1H3,(H,12,13,14);3-4H2,1-2H3;/q;;+1/p-1.
What are the key properties of sodium;decanoyl sulfate;ethoxyethane?
sodium;decanoyl sulfate;ethoxyethane has a molecular weight of 348.44 g/mol, XLogP of 0.18, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;decanoyl sulfate;ethoxyethane is sourced from PubChem (CID 155316659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).