C40H42N6O4 — CID 155319107
1-[4-[N-[5-[3-(6-amino-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]pentyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile (PubChem CID 155319107) has the molecular formula C40H42N6O4 and a molecular weight of 670.81 g/mol. Its IUPAC name is 1-[4-[N-[5-[3-(6-amino-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]pentyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[N-[5-[3-(6-amino-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]pentyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 155319107 |
| Molecular Formula | C40H42N6O4 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 1-[4-[N-[5-[3-(6-amino-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]pentyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1N(CCCCCN1C(=O)CCC(N2Cc3cc(N)ccc3C2=O)C1=O)c1ccc(C2(C#N)CC2)cc1 |
| InChI | InChI=1S/C40H42N6O4/c1-25-7-8-28(37-26(2)43-50-27(37)3)22-35(25)44(32-12-9-30(10-13-32)40(24-41)17-18-40)19-5-4-6-20-45-36(47)16-15-34(39(45)49)46-23-29-21-31(42)11-14-33(29)38(46)48/h7-14,21-22,34H,4-6,15-20,23,42H2,1-3H3 |
| InChIKey | HUFFITNMIHQQTG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|