C11H13NO3 — CID 15531988
3,3-bis(hydroxymethyl)-1-methylindol-2-one (PubChem CID 15531988) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3,3-bis(hydroxymethyl)-1-methylindol-2-one.
| Compound Name | 3,3-bis(hydroxymethyl)-1-methylindol-2-one |
|---|---|
| PubChem CID | 15531988 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3,3-bis(hydroxymethyl)-1-methylindol-2-one |
| SMILES | CN1C(=O)C(CO)(CO)c2ccccc21 |
| InChI | InChI=1S/C11H13NO3/c1-12-9-5-3-2-4-8(9)11(6-13,7-14)10(12)15/h2-5,13-14H,6-7H2,1H3 |
| InChIKey | VXDNHWWDVVOMOV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |