C20H24Cl2N6OS — CID 155323370
3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-[(2,3-dichloro-4-pyridinyl)sulfanyl]-5-methylpyrazine-2-carboxamide (PubChem CID 155323370) has the molecular formula C20H24Cl2N6OS and a molecular weight of 467.43 g/mol. Its IUPAC name is 3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-[(2,3-dichloro-4-pyridinyl)sulfanyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | 3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-[(2,3-dichloro-4-pyridinyl)sulfanyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155323370 |
| Molecular Formula | C20H24Cl2N6OS |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-(4-amino-8-azaspiro[4.5]decan-8-yl)-6-[(2,3-dichloro-4-pyridinyl)sulfanyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1nc(N2CCC3(CCCC3N)CC2)c(C(N)=O)nc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C20H24Cl2N6OS/c1-11-19(30-12-4-8-25-16(22)14(12)21)27-15(17(24)29)18(26-11)28-9-6-20(7-10-28)5-2-3-13(20)23/h4,8,13H,2-3,5-7,9-10,23H2,1H3,(H2,24,29) |
| InChIKey | PVJCXWQYZLUFGD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|