C24H28BrCl2N5O2S — CID 175867789
tert-butyl N-[8-[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-ylidene]carbamate (PubChem CID 175867789) has the molecular formula C24H28BrCl2N5O2S and a molecular weight of 601.40 g/mol. Its IUPAC name is tert-butyl N-[8-[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-ylidene]carbamate.
| Compound Name | tert-butyl N-[8-[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-ylidene]carbamate |
|---|---|
| PubChem CID | 175867789 |
| Molecular Formula | C24H28BrCl2N5O2S |
| Molecular Weight | 601.40 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | tert-butyl N-[8-[3-bromo-5-[(2,3-dichloro-4-pyridinyl)sulfanyl]-6-methylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-ylidene]carbamate |
| SMILES | Cc1nc(N2CCC3(CCCC3=NC(=O)OC(C)(C)C)CC2)c(Br)nc1Sc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C24H28BrCl2N5O2S/c1-14-21(35-15-7-11-28-19(27)17(15)26)31-18(25)20(29-14)32-12-9-24(10-13-32)8-5-6-16(24)30-22(33)34-23(2,3)4/h7,11H,5-6,8-10,12-13H2,1-4H3 |
| InChIKey | FVGMLEGLPPAXOX-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 80.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.40 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|