C9H13NS — CID 155323428
(2E,4E)-2-ethyl-4-sulfanylhepta-2,4-dienenitrile (PubChem CID 155323428) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (2E,4E)-2-ethyl-4-sulfanylhepta-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-ethyl-4-sulfanylhepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 155323428 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (2E,4E)-2-ethyl-4-sulfanylhepta-2,4-dienenitrile |
| SMILES | CC/C=C(S)\C=C(\C#N)CC |
| InChI | InChI=1S/C9H13NS/c1-3-5-9(11)6-8(4-2)7-10/h5-6,11H,3-4H2,1-2H3/b8-6+,9-5+ |
| InChIKey | UWKPYRBFNQNMBG-RFSWUZDDSA-N |
| XLogP | 3.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|